C31H48ClN5O4Si2 — CID 86664799
methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate (PubChem CID 86664799) has the molecular formula C31H48ClN5O4Si2 and a molecular weight of 646.38 g/mol. Its IUPAC name is methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86664799 |
| Molecular Formula | C31H48ClN5O4Si2 |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(Cl)nc4)c3n2)CC1 |
| InChI | InChI=1S/C31H48ClN5O4Si2/c1-39-31(38)24-10-8-23(9-11-24)27-18-29(37-30(35-27)26(20-34-37)25-12-13-28(32)33-19-25)36(21-40-14-16-42(2,3)4)22-41-15-17-43(5,6)7/h12-13,18-20,23-24H,8-11,14-17,21-22H2,1-7H3 |
| InChIKey | WQSNBLAWUHRPQW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|