C36H52N4O4Si2 — CID 123587798
2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-naphthalen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid (PubChem CID 123587798) has the molecular formula C36H52N4O4Si2 and a molecular weight of 661.01 g/mol. Its IUPAC name is 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-naphthalen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-naphthalen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 123587798 |
| Molecular Formula | C36H52N4O4Si2 |
| Molecular Weight | 661.01 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-naphthalen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(CC(=O)O)CC2)nc2c(-c3ccc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C36H52N4O4Si2/c1-45(2,3)19-17-43-25-39(26-44-18-20-46(4,5)6)34-23-33(29-13-11-27(12-14-29)21-35(41)42)38-36-32(24-37-40(34)36)31-16-15-28-9-7-8-10-30(28)22-31/h7-10,15-16,22-24,27,29H,11-14,17-21,25-26H2,1-6H3,(H,41,42) |
| InChIKey | HMAARSODXDOLHX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.01 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|