C24H41IN4O3Si2 — CID 66583652
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexan-1-one (PubChem CID 66583652) has the molecular formula C24H41IN4O3Si2 and a molecular weight of 616.69 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexan-1-one.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 66583652 |
| Molecular Formula | C24H41IN4O3Si2 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexan-1-one |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(=O)CC2)nc2c(I)cnn12 |
| InChI | InChI=1S/C24H41IN4O3Si2/c1-33(2,3)13-11-31-17-28(18-32-12-14-34(4,5)6)23-15-22(19-7-9-20(30)10-8-19)27-24-21(25)16-26-29(23)24/h15-16,19H,7-14,17-18H2,1-6H3 |
| InChIKey | QRMBZMYEFXEJTB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|