C26H45N5O3Si2 — CID 66583526
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-1-methoxycyclohexane-1-carbonitrile (PubChem CID 66583526) has the molecular formula C26H45N5O3Si2 and a molecular weight of 531.85 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-1-methoxycyclohexane-1-carbonitrile.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-1-methoxycyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 66583526 |
| Molecular Formula | C26H45N5O3Si2 |
| Molecular Weight | 531.85 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-1-methoxycyclohexane-1-carbonitrile |
| SMILES | COC1(C#N)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3nccc3n2)CC1 |
| InChI | InChI=1S/C26H45N5O3Si2/c1-32-26(19-27)11-8-22(9-12-26)23-18-25(31-24(29-23)10-13-28-31)30(20-33-14-16-35(2,3)4)21-34-15-17-36(5,6)7/h10,13,18,22H,8-9,11-12,14-17,20-21H2,1-7H3 |
| InChIKey | YAJQVBAXMPFCBC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 84.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.85 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|