C25H28FN3O3Si — CID 165392032
2-(4-fluoro-2-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165392032) has the molecular formula C25H28FN3O3Si and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165392032 |
| Molecular Formula | C25H28FN3O3Si |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(F)ccc1-c1c(C(=O)O)cc(-c2ccnc3[nH]ccc23)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H28FN3O3Si/c1-16-13-17(26)5-6-18(16)23-21(25(30)31)14-22(29(23)15-32-11-12-33(2,3)4)19-7-9-27-24-20(19)8-10-28-24/h5-10,13-14H,11-12,15H2,1-4H3,(H,27,28)(H,30,31) |
| InChIKey | YHLRKPKHBREDMN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|