C24H26F2N4O2Si — CID 165391916
2-(3,4-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 165391916) has the molecular formula C24H26F2N4O2Si and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 2-(3,4-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165391916 |
| Molecular Formula | C24H26F2N4O2Si |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3[nH]ccc23)cc(C(N)=O)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H26F2N4O2Si/c1-33(2,3)11-10-32-14-30-21(16-6-8-28-24-17(16)7-9-29-24)13-18(23(27)31)22(30)15-4-5-19(25)20(26)12-15/h4-9,12-13H,10-11,14H2,1-3H3,(H2,27,31)(H,28,29) |
| InChIKey | JEHHKAJNGQDNNY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|