C30H30N4O2SSi — CID 165391919
2-dibenzothiophen-4-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 165391919) has the molecular formula C30H30N4O2SSi and a molecular weight of 538.75 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 2-dibenzothiophen-4-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165391919 |
| Molecular Formula | C30H30N4O2SSi |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2-dibenzothiophen-4-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3[nH]ccc23)cc(C(N)=O)c1-c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C30H30N4O2SSi/c1-38(2,3)16-15-36-18-34-25(19-11-13-32-30-22(19)12-14-33-30)17-24(29(31)35)27(34)23-9-6-8-21-20-7-4-5-10-26(20)37-28(21)23/h4-14,17H,15-16,18H2,1-3H3,(H2,31,35)(H,32,33) |
| InChIKey | CITZNZIENHOOMO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|