C18H24N4O2Si — CID 170649361
5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 170649361) has the molecular formula C18H24N4O2Si and a molecular weight of 356.50 g/mol. Its IUPAC name is 5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 170649361 |
| Molecular Formula | C18H24N4O2Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(C(N)=O)cc1-c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C18H24N4O2Si/c1-25(2,3)9-8-24-12-22-11-13(17(19)23)10-16(22)14-4-6-20-18-15(14)5-7-21-18/h4-7,10-11H,8-9,12H2,1-3H3,(H2,19,23)(H,20,21) |
| InChIKey | LCNXZHIOSCQSRG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|