C13H10N4O — CID 164603219
6-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyridine-3-carboxamide (PubChem CID 164603219) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164603219 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(-c2ccnc3[nH]ccc23)nc1 |
| InChI | InChI=1S/C13H10N4O/c14-12(18)8-1-2-11(17-7-8)9-3-5-15-13-10(9)4-6-16-13/h1-7H,(H2,14,18)(H,15,16) |
| InChIKey | XIZBVLYAPMLAES-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |