C28H35FN4O2Si — CID 165391801
2-(2-fluoro-4-methylphenyl)-4-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 165391801) has the molecular formula C28H35FN4O2Si and a molecular weight of 506.70 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)-4-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-methylphenyl)-4-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165391801 |
| Molecular Formula | C28H35FN4O2Si |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)-4-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(-c2c(C(N)=O)c(C(C)C)c(-c3ccnc4[nH]ccc34)n2COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C28H35FN4O2Si/c1-17(2)23-24(27(30)34)26(21-8-7-18(3)15-22(21)29)33(16-35-13-14-36(4,5)6)25(23)19-9-11-31-28-20(19)10-12-32-28/h7-12,15,17H,13-14,16H2,1-6H3,(H2,30,34)(H,31,32) |
| InChIKey | IFVZVDRAVSWDNP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|