C27H29FN4O2Si — CID 165391818
4-(2-fluoro-4-methylphenyl)-7-methylidene-3-(2-trimethylsilylethoxymethyl)-3,10,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),4,8,11,13-hexaene-5-carboxamide (PubChem CID 165391818) has the molecular formula C27H29FN4O2Si and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylphenyl)-7-methylidene-3-(2-trimethylsilylethoxymethyl)-3,10,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),4,8,11,13-hexaene-5-carboxamide.
| Compound Name | 4-(2-fluoro-4-methylphenyl)-7-methylidene-3-(2-trimethylsilylethoxymethyl)-3,10,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),4,8,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 165391818 |
| Molecular Formula | C27H29FN4O2Si |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-(2-fluoro-4-methylphenyl)-7-methylidene-3-(2-trimethylsilylethoxymethyl)-3,10,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),4,8,11,13-hexaene-5-carboxamide |
| SMILES | C=c1c2c[nH]c3nccc(c32)c2c1c(C(N)=O)c(-c1ccc(C)cc1F)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H29FN4O2Si/c1-15-6-7-17(20(28)12-15)24-23(26(29)33)21-16(2)19-13-31-27-22(19)18(8-9-30-27)25(21)32(24)14-34-10-11-35(3,4)5/h6-9,12-13H,2,10-11,14H2,1,3-5H3,(H2,29,33)(H,30,31) |
| InChIKey | PEVVRCSRLMNIHM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|