C15H21F2N3OSi — CID 177157501
3-fluoro-4-[3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline (PubChem CID 177157501) has the molecular formula C15H21F2N3OSi and a molecular weight of 325.44 g/mol. Its IUPAC name is 3-fluoro-4-[3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline.
| Compound Name | 3-fluoro-4-[3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline |
|---|---|
| PubChem CID | 177157501 |
| Molecular Formula | C15H21F2N3OSi |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-fluoro-4-[3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc(N)cc2F)c(F)n1 |
| InChI | InChI=1S/C15H21F2N3OSi/c1-22(2,3)7-6-21-10-20-9-13(15(17)19-20)12-5-4-11(18)8-14(12)16/h4-5,8-9H,6-7,10,18H2,1-3H3 |
| InChIKey | PTBUNBIFTGSCTO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|