C16H20BrF3N2OSi — CID 141369945
2-[[3-(2-bromophenyl)-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 141369945) has the molecular formula C16H20BrF3N2OSi and a molecular weight of 421.33 g/mol. Its IUPAC name is 2-[[3-(2-bromophenyl)-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2-bromophenyl)-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141369945 |
| Molecular Formula | C16H20BrF3N2OSi |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[[3-(2-bromophenyl)-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C16H20BrF3N2OSi/c1-24(2,3)9-8-23-11-22-10-13(16(18,19)20)15(21-22)12-6-4-5-7-14(12)17/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | VIPVNSWMWBDDBW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|