C15H22IN3OSi — CID 147098529
2-[[4-iodo-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 147098529) has the molecular formula C15H22IN3OSi and a molecular weight of 415.35 g/mol. Its IUPAC name is 2-[[4-iodo-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-iodo-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 147098529 |
| Molecular Formula | C15H22IN3OSi |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[[4-iodo-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc(-c2nn(COCC[Si](C)(C)C)cc2I)n1 |
| InChI | InChI=1S/C15H22IN3OSi/c1-12-6-5-7-14(17-12)15-13(16)10-19(18-15)11-20-8-9-21(2,3)4/h5-7,10H,8-9,11H2,1-4H3 |
| InChIKey | BKEXQMLRYZQBPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|