C22H23FN6OSi — CID 153434279
2-[[3-(6-fluoro-2-pyridinyl)-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153434279) has the molecular formula C22H23FN6OSi and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-[[3-(6-fluoro-2-pyridinyl)-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(6-fluoro-2-pyridinyl)-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153434279 |
| Molecular Formula | C22H23FN6OSi |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[[3-(6-fluoro-2-pyridinyl)-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3cn(COCC[Si](C)(C)C)nc3-c3cccc(F)n3)cn12 |
| InChI | InChI=1S/C22H23FN6OSi/c1-24-21-12-25-20-9-8-16(13-29(20)21)17-14-28(15-30-10-11-31(2,3)4)27-22(17)18-6-5-7-19(23)26-18/h5-9,12-14H,10-11,15H2,2-4H3 |
| InChIKey | OKBOAUSZVJDGDK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|