C45H46FN5O2Si — CID 69350340
2-[[4-[4-fluoro-3-[1-(2-trityloxyethyl)imidazol-4-yl]phenyl]-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 69350340) has the molecular formula C45H46FN5O2Si and a molecular weight of 735.98 g/mol. Its IUPAC name is 2-[[4-[4-fluoro-3-[1-(2-trityloxyethyl)imidazol-4-yl]phenyl]-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[4-fluoro-3-[1-(2-trityloxyethyl)imidazol-4-yl]phenyl]-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 69350340 |
| Molecular Formula | C45H46FN5O2Si |
| Molecular Weight | 735.98 g/mol |
| Exact Mass | 735.34 |
| IUPAC Name | 2-[[4-[4-fluoro-3-[1-(2-trityloxyethyl)imidazol-4-yl]phenyl]-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc(-c2nn(COCC[Si](C)(C)C)cc2-c2ccc(F)c(-c3cn(CCOC(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)c2)n1 |
| InChI | InChI=1S/C45H46FN5O2Si/c1-34-15-14-22-42(48-34)44-40(30-51(49-44)33-52-27-28-54(2,3)4)35-23-24-41(46)39(29-35)43-31-50(32-47-43)25-26-53-45(36-16-8-5-9-17-36,37-18-10-6-11-19-37)38-20-12-7-13-21-38/h5-24,29-32H,25-28,33H2,1-4H3 |
| InChIKey | PAYOHPVBWXJGAQ-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.98 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|