C24H26FN5OSi — CID 153434198
6-[3-(4-fluoro-3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 153434198) has the molecular formula C24H26FN5OSi and a molecular weight of 447.59 g/mol. Its IUPAC name is 6-[3-(4-fluoro-3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 6-[3-(4-fluoro-3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 153434198 |
| Molecular Formula | C24H26FN5OSi |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 6-[3-(4-fluoro-3-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2nn(COCC[Si](C)(C)C)cc2-c2ccc3ncc(C#N)n3c2)ccc1F |
| InChI | InChI=1S/C24H26FN5OSi/c1-17-11-18(5-7-22(17)25)24-21(15-29(28-24)16-31-9-10-32(2,3)4)19-6-8-23-27-13-20(12-26)30(23)14-19/h5-8,11,13-15H,9-10,16H2,1-4H3 |
| InChIKey | MJXGSZZGNIZZLX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 68.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|