C26H30FN5OSi — CID 151926075
6-[3-(4-fluorophenyl)-5-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 151926075) has the molecular formula C26H30FN5OSi and a molecular weight of 475.64 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)-5-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 6-[3-(4-fluorophenyl)-5-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 151926075 |
| Molecular Formula | C26H30FN5OSi |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 6-[3-(4-fluorophenyl)-5-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | CC(C)c1c(-c2ccc3ncc(C#N)n3c2)c(-c2ccc(F)cc2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H30FN5OSi/c1-18(2)26-24(20-8-11-23-29-15-22(14-28)31(23)16-20)25(19-6-9-21(27)10-7-19)30-32(26)17-33-12-13-34(3,4)5/h6-11,15-16,18H,12-13,17H2,1-5H3 |
| InChIKey | SXTYQLLSOZANGT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 68.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|