C23H25BrN6OSi — CID 153434182
2-[[5-bromo-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153434182) has the molecular formula C23H25BrN6OSi and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-[[5-bromo-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153434182 |
| Molecular Formula | C23H25BrN6OSi |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 2-[[5-bromo-4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4cccc(C)n4)nn(COCC[Si](C)(C)C)c3Br)cn12 |
| InChI | InChI=1S/C23H25BrN6OSi/c1-16-7-6-8-18(27-16)22-21(17-9-10-19-26-13-20(25-2)29(19)14-17)23(24)30(28-22)15-31-11-12-32(3,4)5/h6-10,13-14H,11-12,15H2,1,3-5H3 |
| InChIKey | QXVXDQPXZBNOQO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|