C25H31N5OSi — CID 153434265
2-[[5-cyclopropyl-4-imidazo[1,2-a]pyridin-6-yl-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153434265) has the molecular formula C25H31N5OSi and a molecular weight of 445.64 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-4-imidazo[1,2-a]pyridin-6-yl-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-cyclopropyl-4-imidazo[1,2-a]pyridin-6-yl-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153434265 |
| Molecular Formula | C25H31N5OSi |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-[[5-cyclopropyl-4-imidazo[1,2-a]pyridin-6-yl-3-(6-methyl-2-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc(-c2nn(COCC[Si](C)(C)C)c(C3CC3)c2-c2ccc3nccn3c2)n1 |
| InChI | InChI=1S/C25H31N5OSi/c1-18-6-5-7-21(27-18)24-23(20-10-11-22-26-12-13-29(22)16-20)25(19-8-9-19)30(28-24)17-31-14-15-32(2,3)4/h5-7,10-13,16,19H,8-9,14-15,17H2,1-4H3 |
| InChIKey | ATBQPRZWHRKCKW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|