C25H31ClN4OSi — CID 152563745
2-[[3-(4-chlorophenyl)-4-imidazo[1,2-a]pyridin-6-yl-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 152563745) has the molecular formula C25H31ClN4OSi and a molecular weight of 467.09 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-4-imidazo[1,2-a]pyridin-6-yl-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(4-chlorophenyl)-4-imidazo[1,2-a]pyridin-6-yl-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 152563745 |
| Molecular Formula | C25H31ClN4OSi |
| Molecular Weight | 467.09 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-4-imidazo[1,2-a]pyridin-6-yl-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)c1c(-c2ccc3nccn3c2)c(-c2ccc(Cl)cc2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H31ClN4OSi/c1-18(2)25-23(20-8-11-22-27-12-13-29(22)16-20)24(19-6-9-21(26)10-7-19)28-30(25)17-31-14-15-32(3,4)5/h6-13,16,18H,14-15,17H2,1-5H3 |
| InChIKey | YQAQKIGQZRNKGA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.09 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|