C21H25ClN6OSi — CID 162761018
2-[[4-[3-(5-chloro-2-pyridinyl)-1-methylpyrazol-4-yl]pyrazolo[3,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 162761018) has the molecular formula C21H25ClN6OSi and a molecular weight of 441.01 g/mol. Its IUPAC name is 2-[[4-[3-(5-chloro-2-pyridinyl)-1-methylpyrazol-4-yl]pyrazolo[3,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[3-(5-chloro-2-pyridinyl)-1-methylpyrazol-4-yl]pyrazolo[3,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162761018 |
| Molecular Formula | C21H25ClN6OSi |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[[4-[3-(5-chloro-2-pyridinyl)-1-methylpyrazol-4-yl]pyrazolo[3,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cn1cc(-c2ccnc3c2cnn3COCC[Si](C)(C)C)c(-c2ccc(Cl)cn2)n1 |
| InChI | InChI=1S/C21H25ClN6OSi/c1-27-13-18(20(26-27)19-6-5-15(22)11-24-19)16-7-8-23-21-17(16)12-25-28(21)14-29-9-10-30(2,3)4/h5-8,11-13H,9-10,14H2,1-4H3 |
| InChIKey | AQGLRTZNQBIDSQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|