C26H33ClFN7O2Si — CID 171781472
N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 171781472) has the molecular formula C26H33ClFN7O2Si and a molecular weight of 558.13 g/mol. Its IUPAC name is N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 171781472 |
| Molecular Formula | C26H33ClFN7O2Si |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[6-(5-chloro-2-fluorophenyl)-3-[2-(dimethylamino)ethoxy]pyridazin-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CN(C)CCOc1nnc(-c2cc(Cl)ccc2F)cc1Nc1ccnc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H33ClFN7O2Si/c1-34(2)10-11-37-26-24(15-23(32-33-26)19-14-18(27)6-7-21(19)28)31-22-8-9-29-25-20(22)16-30-35(25)17-36-12-13-38(3,4)5/h6-9,14-16H,10-13,17H2,1-5H3,(H,29,31,32) |
| InChIKey | DJFQQRRKNFMWOL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|