C19H22ClF2N5OSi — CID 162440754
2-chloro-5-fluoro-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]pyrimidin-4-amine (PubChem CID 162440754) has the molecular formula C19H22ClF2N5OSi and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 162440754 |
| Molecular Formula | C19H22ClF2N5OSi |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-chloro-5-fluoro-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ncc(-c2ccc(Nc3nc(Cl)ncc3F)cc2)c1F |
| InChI | InChI=1S/C19H22ClF2N5OSi/c1-29(2,3)9-8-28-12-27-17(22)15(10-24-27)13-4-6-14(7-5-13)25-18-16(21)11-23-19(20)26-18/h4-7,10-11H,8-9,12H2,1-3H3,(H,23,25,26) |
| InChIKey | AOJYVWIECRPZAS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|