C18H17ClFN5O2 — CID 175916540
tert-butyl 3-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]pyrazole-1-carboxylate (PubChem CID 175916540) has the molecular formula C18H17ClFN5O2 and a molecular weight of 389.82 g/mol. Its IUPAC name is tert-butyl 3-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 175916540 |
| Molecular Formula | C18H17ClFN5O2 |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | tert-butyl 3-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(-c2ccc(Nc3nc(Cl)ncc3F)cc2)n1 |
| InChI | InChI=1S/C18H17ClFN5O2/c1-18(2,3)27-17(26)25-9-8-14(24-25)11-4-6-12(7-5-11)22-15-13(20)10-21-16(19)23-15/h4-10H,1-3H3,(H,21,22,23) |
| InChIKey | YXCYONIVUWDMIN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |