C12H12Cl2N4O2 — CID 170699324
tert-butyl 3-(2,5-dichloropyrimidin-4-yl)pyrazole-1-carboxylate (PubChem CID 170699324) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is tert-butyl 3-(2,5-dichloropyrimidin-4-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-(2,5-dichloropyrimidin-4-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 170699324 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | tert-butyl 3-(2,5-dichloropyrimidin-4-yl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(-c2nc(Cl)ncc2Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-12(2,3)20-11(19)18-5-4-8(17-18)9-7(13)6-15-10(14)16-9/h4-6H,1-3H3 |
| InChIKey | PRGNRZXUAKZNOS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |