C17H15Cl2N3O2 — CID 171839816
tert-butyl 4-(2,5-dichloropyrimidin-4-yl)indole-1-carboxylate (PubChem CID 171839816) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is tert-butyl 4-(2,5-dichloropyrimidin-4-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 4-(2,5-dichloropyrimidin-4-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 171839816 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | tert-butyl 4-(2,5-dichloropyrimidin-4-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2c(-c3nc(Cl)ncc3Cl)cccc21 |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-17(2,3)24-16(23)22-8-7-10-11(5-4-6-13(10)22)14-12(18)9-20-15(19)21-14/h4-9H,1-3H3 |
| InChIKey | YWINYPUPADURMM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |