C12H13ClN2O2 — CID 86689827
tert-butyl 5-chloropyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 86689827) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is tert-butyl 5-chloropyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-chloropyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86689827 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | tert-butyl 5-chloropyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2nc(Cl)ccc21 |
| InChI | InChI=1S/C12H13ClN2O2/c1-12(2,3)17-11(16)15-7-6-8-9(15)4-5-10(13)14-8/h4-7H,1-3H3 |
| InChIKey | APZUXUUKXSFFJF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|