C14H17N3O3 — CID 136602521
tert-butyl 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]pyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 136602521) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is tert-butyl 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]pyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]pyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 136602521 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]pyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | C/C(=N\O)c1ccc2c(ccn2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C14H17N3O3/c1-9(16-19)10-5-6-12-11(15-10)7-8-17(12)13(18)20-14(2,3)4/h5-8,19H,1-4H3/b16-9+ |
| InChIKey | NMLNKNYNQBVEJR-CXUHLZMHSA-N |
| XLogP | 3.02 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|