C13H11ClFN3O4 — CID 175245077
methyl 2-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-hydroxyphenoxy]acetate (PubChem CID 175245077) has the molecular formula C13H11ClFN3O4 and a molecular weight of 327.70 g/mol. Its IUPAC name is methyl 2-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-hydroxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-hydroxyphenoxy]acetate |
|---|---|
| PubChem CID | 175245077 |
| Molecular Formula | C13H11ClFN3O4 |
| Molecular Weight | 327.70 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | methyl 2-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-hydroxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Nc2nc(Cl)ncc2F)cc1O |
| InChI | InChI=1S/C13H11ClFN3O4/c1-21-11(20)6-22-10-3-2-7(4-9(10)19)17-12-8(15)5-16-13(14)18-12/h2-5,19H,6H2,1H3,(H,16,17,18) |
| InChIKey | DJUDDWPUVVIYQE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |