C14H13ClFN3O4S — CID 176913369
methyl 4-[(2-chloro-5-ethylsulfonylpyrimidin-4-yl)amino]-2-fluorobenzoate (PubChem CID 176913369) has the molecular formula C14H13ClFN3O4S and a molecular weight of 373.79 g/mol. Its IUPAC name is methyl 4-[(2-chloro-5-ethylsulfonylpyrimidin-4-yl)amino]-2-fluorobenzoate.
| Compound Name | methyl 4-[(2-chloro-5-ethylsulfonylpyrimidin-4-yl)amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 176913369 |
| Molecular Formula | C14H13ClFN3O4S |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | methyl 4-[(2-chloro-5-ethylsulfonylpyrimidin-4-yl)amino]-2-fluorobenzoate |
| SMILES | CCS(=O)(=O)c1cnc(Cl)nc1Nc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C14H13ClFN3O4S/c1-3-24(21,22)11-7-17-14(15)19-12(11)18-8-4-5-9(10(16)6-8)13(20)23-2/h4-7H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | XMRYUJLOBHWDII-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |