C16H16ClF2N5O — CID 166477852
1-[4-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-fluorophenyl]piperazin-1-yl]ethanone (PubChem CID 166477852) has the molecular formula C16H16ClF2N5O and a molecular weight of 367.79 g/mol. Its IUPAC name is 1-[4-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-fluorophenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-fluorophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 166477852 |
| Molecular Formula | C16H16ClF2N5O |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-[4-[4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-fluorophenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3nc(Cl)ncc3F)cc2F)CC1 |
| InChI | InChI=1S/C16H16ClF2N5O/c1-10(25)23-4-6-24(7-5-23)14-3-2-11(8-12(14)18)21-15-13(19)9-20-16(17)22-15/h2-3,8-9H,4-7H2,1H3,(H,20,21,22) |
| InChIKey | HLAZTLSUNJMFNB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|