C18H15ClFN5O2 — CID 87189179
[5-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-3-pyridinyl]carbamic acid (PubChem CID 87189179) has the molecular formula C18H15ClFN5O2 and a molecular weight of 387.80 g/mol. Its IUPAC name is [5-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-3-pyridinyl]carbamic acid.
| Compound Name | [5-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 87189179 |
| Molecular Formula | C18H15ClFN5O2 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [5-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-3-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1cncc(CCc2cccc(Nc3nc(Cl)ncc3F)c2)c1 |
| InChI | InChI=1S/C18H15ClFN5O2/c19-17-22-10-15(20)16(25-17)23-13-3-1-2-11(6-13)4-5-12-7-14(9-21-8-12)24-18(26)27/h1-3,6-10,24H,4-5H2,(H,26,27)(H,22,23,25) |
| InChIKey | LDDYWXHOKSJCBH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |