C18H15ClFN5O2 — CID 87196888
[4-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-2-pyridinyl] carbamate (PubChem CID 87196888) has the molecular formula C18H15ClFN5O2 and a molecular weight of 387.80 g/mol. Its IUPAC name is [4-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-2-pyridinyl] carbamate.
| Compound Name | [4-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 87196888 |
| Molecular Formula | C18H15ClFN5O2 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [4-[2-[3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]phenyl]ethyl]-2-pyridinyl] carbamate |
| SMILES | NC(=O)Oc1cc(CCc2cccc(Nc3nc(Cl)ncc3F)c2)ccn1 |
| InChI | InChI=1S/C18H15ClFN5O2/c19-17-23-10-14(20)16(25-17)24-13-3-1-2-11(8-13)4-5-12-6-7-22-15(9-12)27-18(21)26/h1-3,6-10H,4-5H2,(H2,21,26)(H,23,24,25) |
| InChIKey | RZWJXODFICPLIP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |