C17H17ClN6O2 — CID 139474896
tert-butyl 4-[5-[(2-chloropyrimidin-4-yl)amino]-2-pyridinyl]pyrazole-1-carboxylate (PubChem CID 139474896) has the molecular formula C17H17ClN6O2 and a molecular weight of 372.82 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2-chloropyrimidin-4-yl)amino]-2-pyridinyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2-chloropyrimidin-4-yl)amino]-2-pyridinyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 139474896 |
| Molecular Formula | C17H17ClN6O2 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | tert-butyl 4-[5-[(2-chloropyrimidin-4-yl)amino]-2-pyridinyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccc(Nc3ccnc(Cl)n3)cn2)cn1 |
| InChI | InChI=1S/C17H17ClN6O2/c1-17(2,3)26-16(25)24-10-11(8-21-24)13-5-4-12(9-20-13)22-14-6-7-19-15(18)23-14/h4-10H,1-3H3,(H,19,22,23) |
| InChIKey | MXGVZHPBPSDGAM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |