C22H22FN5O — CID 175920695
4-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-1-[2-(oxetan-3-yl)propyl]pyrrolo[2,3-b]pyridine (PubChem CID 175920695) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-1-[2-(oxetan-3-yl)propyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-1-[2-(oxetan-3-yl)propyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 175920695 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-1-[2-(oxetan-3-yl)propyl]pyrrolo[2,3-b]pyridine |
| SMILES | CC(Cn1ccc2c(-c3cn(C)nc3-c3ccc(F)cn3)ccnc21)C1COC1 |
| InChI | InChI=1S/C22H22FN5O/c1-14(15-12-29-13-15)10-28-8-6-18-17(5-7-24-22(18)28)19-11-27(2)26-21(19)20-4-3-16(23)9-25-20/h3-9,11,14-15H,10,12-13H2,1-2H3 |
| InChIKey | YLZOMSAFAFEJOQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|