C27H31FN4O — CID 175980284
4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]-1-(3-methoxy-2-methylpropyl)pyrrolo[2,3-b]pyridine (PubChem CID 175980284) has the molecular formula C27H31FN4O and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]-1-(3-methoxy-2-methylpropyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]-1-(3-methoxy-2-methylpropyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 175980284 |
| Molecular Formula | C27H31FN4O |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]-1-(3-methoxy-2-methylpropyl)pyrrolo[2,3-b]pyridine |
| SMILES | COCC(C)Cn1ccc2c(-c3c(-c4ccc(F)cc4)ncn3C3CCCCC3)ccnc21 |
| InChI | InChI=1S/C27H31FN4O/c1-19(17-33-2)16-31-15-13-24-23(12-14-29-27(24)31)26-25(20-8-10-21(28)11-9-20)30-18-32(26)22-6-4-3-5-7-22/h8-15,18-19,22H,3-7,16-17H2,1-2H3 |
| InChIKey | IVEIWMKOFALEOL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|