C22H22N4 — CID 139553377
4-(3-cyclohexyl-5-phenylimidazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 139553377) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-(3-cyclohexyl-5-phenylimidazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(3-cyclohexyl-5-phenylimidazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 139553377 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-(3-cyclohexyl-5-phenylimidazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccc(-c2ncn(C3CCCCC3)c2-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C22H22N4/c1-3-7-16(8-4-1)20-21(18-11-13-23-22-19(18)12-14-24-22)26(15-25-20)17-9-5-2-6-10-17/h1,3-4,7-8,11-15,17H,2,5-6,9-10H2,(H,23,24) |
| InChIKey | KXUZTOKQEHKJCV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |