C26H32N6OSi — CID 153434240
2-[[4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153434240) has the molecular formula C26H32N6OSi and a molecular weight of 472.67 g/mol. Its IUPAC name is 2-[[4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153434240 |
| Molecular Formula | C26H32N6OSi |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[[4-(3-isocyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-5-propan-2-ylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4cccc(C)n4)nn(COCC[Si](C)(C)C)c3C(C)C)cn12 |
| InChI | InChI=1S/C26H32N6OSi/c1-18(2)26-24(20-11-12-22-28-15-23(27-4)31(22)16-20)25(21-10-8-9-19(3)29-21)30-32(26)17-33-13-14-34(5,6)7/h8-12,15-16,18H,13-14,17H2,1-3,5-7H3 |
| InChIKey | HTYXFFOBZMGYSX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|