C28H33FN4O3Si — CID 153434238
ethyl 6-[5-cyclopropyl-3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 153434238) has the molecular formula C28H33FN4O3Si and a molecular weight of 520.68 g/mol. Its IUPAC name is ethyl 6-[5-cyclopropyl-3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[5-cyclopropyl-3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 153434238 |
| Molecular Formula | C28H33FN4O3Si |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | ethyl 6-[5-cyclopropyl-3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(-c3c(-c4ccc(F)cc4)nn(COCC[Si](C)(C)C)c3C3CC3)cn12 |
| InChI | InChI=1S/C28H33FN4O3Si/c1-5-36-28(34)23-16-30-24-13-10-21(17-32(23)24)25-26(19-8-11-22(29)12-9-19)31-33(27(25)20-6-7-20)18-35-14-15-37(2,3)4/h8-13,16-17,20H,5-7,14-15,18H2,1-4H3 |
| InChIKey | HLDDHBNRNQAINY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|