C16H25F3N2O3Si — CID 167334496
ethyl 3-cyclopropyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate (PubChem CID 167334496) has the molecular formula C16H25F3N2O3Si and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 3-cyclopropyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-cyclopropyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167334496 |
| Molecular Formula | C16H25F3N2O3Si |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl 3-cyclopropyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)c(C2CC2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H25F3N2O3Si/c1-5-24-15(22)14-12(16(17,18)19)13(11-6-7-11)20-21(14)10-23-8-9-25(2,3)4/h11H,5-10H2,1-4H3 |
| InChIKey | CTENHDKWNJVUOM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|