C14H22F3N3O3Si — CID 167439416
methyl 4-amino-3-(3,3,3-trifluoroprop-1-en-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate (PubChem CID 167439416) has the molecular formula C14H22F3N3O3Si and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl 4-amino-3-(3,3,3-trifluoroprop-1-en-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate.
| Compound Name | methyl 4-amino-3-(3,3,3-trifluoroprop-1-en-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167439416 |
| Molecular Formula | C14H22F3N3O3Si |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl 4-amino-3-(3,3,3-trifluoroprop-1-en-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
| SMILES | C=C(c1nn(COCC[Si](C)(C)C)c(C(=O)OC)c1N)C(F)(F)F |
| InChI | InChI=1S/C14H22F3N3O3Si/c1-9(14(15,16)17)11-10(18)12(13(21)22-2)20(19-11)8-23-6-7-24(3,4)5/h1,6-8,18H2,2-5H3 |
| InChIKey | ZYSQHLSUMPLICS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|