C22H34BFN2O5Si — CID 155711472
methyl 7-fluoro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate (PubChem CID 155711472) has the molecular formula C22H34BFN2O5Si and a molecular weight of 464.42 g/mol. Its IUPAC name is methyl 7-fluoro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate.
| Compound Name | methyl 7-fluoro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 155711472 |
| Molecular Formula | C22H34BFN2O5Si |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | methyl 7-fluoro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)c2c(F)c(B3OC(C)(C)C(C)(C)O3)cc(C)c12 |
| InChI | InChI=1S/C22H34BFN2O5Si/c1-14-12-15(23-30-21(2,3)22(4,5)31-23)17(24)19-16(14)18(20(27)28-6)25-26(19)13-29-10-11-32(7,8)9/h12H,10-11,13H2,1-9H3 |
| InChIKey | YQCGYBIQSGUDMH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|