C19H30BFN2O3Si — CID 163233343
2-[[4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163233343) has the molecular formula C19H30BFN2O3Si and a molecular weight of 392.36 g/mol. Its IUPAC name is 2-[[4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163233343 |
| Molecular Formula | C19H30BFN2O3Si |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[[4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OB(c2cc(F)c3cnn(COCC[Si](C)(C)C)c3c2)OC1(C)C |
| InChI | InChI=1S/C19H30BFN2O3Si/c1-18(2)19(3,4)26-20(25-18)14-10-16(21)15-12-22-23(17(15)11-14)13-24-8-9-27(5,6)7/h10-12H,8-9,13H2,1-7H3 |
| InChIKey | WQQZNYBLGZUZRV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|