C22H39N3O4Si — CID 131748474
tert-butyl 3-(3-hydroxycyclopentyl)-1-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 131748474) has the molecular formula C22H39N3O4Si and a molecular weight of 437.66 g/mol. Its IUPAC name is tert-butyl 3-(3-hydroxycyclopentyl)-1-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-(3-hydroxycyclopentyl)-1-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 131748474 |
| Molecular Formula | C22H39N3O4Si |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | tert-butyl 3-(3-hydroxycyclopentyl)-1-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(c(C3CCC(O)C3)nn2COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C22H39N3O4Si/c1-22(2,3)29-21(27)24-10-9-19-18(14-24)20(16-7-8-17(26)13-16)23-25(19)15-28-11-12-30(4,5)6/h16-17,26H,7-15H2,1-6H3 |
| InChIKey | UMSCYKYYYAGIPT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|