C17H32BrN5O3Si — CID 176911029
tert-butyl 4-[5-bromo-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperazine-1-carboxylate (PubChem CID 176911029) has the molecular formula C17H32BrN5O3Si and a molecular weight of 462.47 g/mol. Its IUPAC name is tert-butyl 4-[5-bromo-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-bromo-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176911029 |
| Molecular Formula | C17H32BrN5O3Si |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | tert-butyl 4-[5-bromo-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nnc(Br)n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C17H32BrN5O3Si/c1-17(2,3)26-16(24)22-9-7-21(8-10-22)15-20-19-14(18)23(15)13-25-11-12-27(4,5)6/h7-13H2,1-6H3 |
| InChIKey | DQPQIRYJSXDSML-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|