C16H22Cl2N6O2 — CID 89039610
tert-butyl 4-(2,6-dichloro-7-ethylpurin-8-yl)piperazine-1-carboxylate (PubChem CID 89039610) has the molecular formula C16H22Cl2N6O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is tert-butyl 4-(2,6-dichloro-7-ethylpurin-8-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,6-dichloro-7-ethylpurin-8-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89039610 |
| Molecular Formula | C16H22Cl2N6O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | tert-butyl 4-(2,6-dichloro-7-ethylpurin-8-yl)piperazine-1-carboxylate |
| SMILES | CCn1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc2nc(Cl)nc(Cl)c21 |
| InChI | InChI=1S/C16H22Cl2N6O2/c1-5-24-10-11(17)19-13(18)20-12(10)21-14(24)22-6-8-23(9-7-22)15(25)26-16(2,3)4/h5-9H2,1-4H3 |
| InChIKey | NJSONDPKCXEUGZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |