C22H37BrN6O5Si — CID 177251627
tert-butyl 4-[2-bromo-5-ethyl-7-oxo-4-(2-trimethylsilylethoxymethoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]piperazine-1-carboxylate (PubChem CID 177251627) has the molecular formula C22H37BrN6O5Si and a molecular weight of 573.57 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-5-ethyl-7-oxo-4-(2-trimethylsilylethoxymethoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-bromo-5-ethyl-7-oxo-4-(2-trimethylsilylethoxymethoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177251627 |
| Molecular Formula | C22H37BrN6O5Si |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | tert-butyl 4-[2-bromo-5-ethyl-7-oxo-4-(2-trimethylsilylethoxymethoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]piperazine-1-carboxylate |
| SMILES | CCc1c(N2CCN(C(=O)OC(C)(C)C)CC2)c(=O)n2nc(Br)nc2n1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C22H37BrN6O5Si/c1-8-16-17(26-9-11-27(12-10-26)21(31)34-22(2,3)4)18(30)28-20(24-19(23)25-28)29(16)33-15-32-13-14-35(5,6)7/h8-15H2,1-7H3 |
| InChIKey | JKRWGRFUPBAERA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|