C22H38N4O6Si — CID 171550480
tert-butyl 4-[5-ethoxycarbonyl-4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopiperazine-1-carboxylate (PubChem CID 171550480) has the molecular formula C22H38N4O6Si and a molecular weight of 482.65 g/mol. Its IUPAC name is tert-butyl 4-[5-ethoxycarbonyl-4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-ethoxycarbonyl-4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171550480 |
| Molecular Formula | C22H38N4O6Si |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | tert-butyl 4-[5-ethoxycarbonyl-4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopiperazine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(N2CCN(C(=O)OC(C)(C)C)CC2=O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H38N4O6Si/c1-9-31-19(28)18-16(2)23-20(26(18)15-30-12-13-33(6,7)8)25-11-10-24(14-17(25)27)21(29)32-22(3,4)5/h9-15H2,1-8H3 |
| InChIKey | SEAPUHWZCAFSIH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|