C27H39BrN6O3Si — CID 123227882
tert-butyl 4-[[6-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 123227882) has the molecular formula C27H39BrN6O3Si and a molecular weight of 603.64 g/mol. Its IUPAC name is tert-butyl 4-[[6-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123227882 |
| Molecular Formula | C27H39BrN6O3Si |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | tert-butyl 4-[[6-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(-c3cc4nc(Br)cnc4n3COCC[Si](C)(C)C)nc2)CC1 |
| InChI | InChI=1S/C27H39BrN6O3Si/c1-27(2,3)37-26(35)33-11-9-32(10-12-33)18-20-7-8-21(29-16-20)23-15-22-25(30-17-24(28)31-22)34(23)19-36-13-14-38(4,5)6/h7-8,15-17H,9-14,18-19H2,1-6H3 |
| InChIKey | XGZVYTRSQJPXIJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|